C33H17F17N2O — CID 102493399
5-[4-[[4-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctyl)phenyl]methoxy]phenyl]-1,10-phenanthroline (PubChem CID 102493399) has the molecular formula C33H17F17N2O and a molecular weight of 780.48 g/mol. Its IUPAC name is 5-[4-[[4-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctyl)phenyl]methoxy]phenyl]-1,10-phenanthroline.
| Compound Name | 5-[4-[[4-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctyl)phenyl]methoxy]phenyl]-1,10-phenanthroline |
|---|---|
| PubChem CID | 102493399 |
| Molecular Formula | C33H17F17N2O |
| Molecular Weight | 780.48 g/mol |
| Exact Mass | 780.11 |
| IUPAC Name | 5-[4-[[4-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctyl)phenyl]methoxy]phenyl]-1,10-phenanthroline |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)c1ccc(COc2ccc(-c3cc4cccnc4c4ncccc34)cc2)cc1 |
| InChI | InChI=1S/C33H17F17N2O/c34-26(35,27(36,37)28(38,39)29(40,41)30(42,43)31(44,45)32(46,47)33(48,49)50)20-9-5-17(6-10-20)16-53-21-11-7-18(8-12-21)23-15-19-3-1-13-51-24(19)25-22(23)4-2-14-52-25/h1-15H,16H2 |
| InChIKey | STQNXSMVLPUSFH-UHFFFAOYSA-N |
| XLogP | 11.49 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 780.48 |
| LogP ≤ 5 | 11.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|