C22H26FN3O2 — CID 10249382
(2S,5R)-5-ethynyl-1-[2-[[4-(4-fluorophenoxy)-1-methylcyclohexyl]amino]acetyl]pyrrolidine-2-carbonitrile (PubChem CID 10249382) has the molecular formula C22H26FN3O2 and a molecular weight of 383.47 g/mol. Its IUPAC name is (2S,5R)-5-ethynyl-1-[2-[[4-(4-fluorophenoxy)-1-methylcyclohexyl]amino]acetyl]pyrrolidine-2-carbonitrile.
| Compound Name | (2S,5R)-5-ethynyl-1-[2-[[4-(4-fluorophenoxy)-1-methylcyclohexyl]amino]acetyl]pyrrolidine-2-carbonitrile |
|---|---|
| PubChem CID | 10249382 |
| Molecular Formula | C22H26FN3O2 |
| Molecular Weight | 383.47 g/mol |
| Exact Mass | 383.20 |
| IUPAC Name | (2S,5R)-5-ethynyl-1-[2-[[4-(4-fluorophenoxy)-1-methylcyclohexyl]amino]acetyl]pyrrolidine-2-carbonitrile |
| SMILES | C#C[C@H]1CC[C@@H](C#N)N1C(=O)CNC1(C)CCC(Oc2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C22H26FN3O2/c1-3-17-6-7-18(14-24)26(17)21(27)15-25-22(2)12-10-20(11-13-22)28-19-8-4-16(23)5-9-19/h1,4-5,8-9,17-18,20,25H,6-7,10-13,15H2,2H3/t17-,18-,20?,22?/m0/s1 |
| InChIKey | IJWUZVSXDWDIEQ-NHUPUQRLSA-N |
| XLogP | 3.01 |
| TPSA | 65.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.47 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|