C20H22BrCl3N2O4 — CID 102494196
(E)-5-[(2R,3S,4R)-6-bromo-3-nitro-2-(trichloromethyl)-3,4-dihydro-2H-chromen-4-yl]-4-piperidin-1-ylpent-3-en-2-one (PubChem CID 102494196) has the molecular formula C20H22BrCl3N2O4 and a molecular weight of 540.67 g/mol. Its IUPAC name is (E)-5-[(2R,3S,4R)-6-bromo-3-nitro-2-(trichloromethyl)-3,4-dihydro-2H-chromen-4-yl]-4-piperidin-1-ylpent-3-en-2-one.
| Compound Name | (E)-5-[(2R,3S,4R)-6-bromo-3-nitro-2-(trichloromethyl)-3,4-dihydro-2H-chromen-4-yl]-4-piperidin-1-ylpent-3-en-2-one |
|---|---|
| PubChem CID | 102494196 |
| Molecular Formula | C20H22BrCl3N2O4 |
| Molecular Weight | 540.67 g/mol |
| Exact Mass | 537.98 |
| IUPAC Name | (E)-5-[(2R,3S,4R)-6-bromo-3-nitro-2-(trichloromethyl)-3,4-dihydro-2H-chromen-4-yl]-4-piperidin-1-ylpent-3-en-2-one |
| SMILES | CC(=O)/C=C(\C[C@@H]1c2cc(Br)ccc2O[C@@H](C(Cl)(Cl)Cl)[C@H]1[N+](=O)[O-])N1CCCCC1 |
| InChI | InChI=1S/C20H22BrCl3N2O4/c1-12(27)9-14(25-7-3-2-4-8-25)11-16-15-10-13(21)5-6-17(15)30-19(20(22,23)24)18(16)26(28)29/h5-6,9-10,16,18-19H,2-4,7-8,11H2,1H3/b14-9+/t16-,18+,19-/m1/s1 |
| InChIKey | BBJSSOXZKNAUAW-KXVIXMSYSA-N |
| XLogP | 5.66 |
| TPSA | 72.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.67 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|