C19H21NO4 — CID 102494673
3,6-bis(1,4-dioxan-2-yl)-2-phenylpyridine (PubChem CID 102494673) has the molecular formula C19H21NO4 and a molecular weight of 327.38 g/mol. Its IUPAC name is 3,6-bis(1,4-dioxan-2-yl)-2-phenylpyridine.
| Compound Name | 3,6-bis(1,4-dioxan-2-yl)-2-phenylpyridine |
|---|---|
| PubChem CID | 102494673 |
| Molecular Formula | C19H21NO4 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.15 |
| IUPAC Name | 3,6-bis(1,4-dioxan-2-yl)-2-phenylpyridine |
| SMILES | c1ccc(-c2nc(C3COCCO3)ccc2C2COCCO2)cc1 |
| InChI | InChI=1S/C19H21NO4/c1-2-4-14(5-3-1)19-15(17-12-21-8-10-23-17)6-7-16(20-19)18-13-22-9-11-24-18/h1-7,17-18H,8-13H2 |
| InChIKey | CRXSEIJLRCVBJU-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 49.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |