About 4-[[3,5-dichloro-2-(cyclopropylmethylamino)-6-fluoro-4-pyridinyl]oxy]-2-propan-2-ylphenol
4-[[3,5-dichloro-2-(cyclopropylmethylamino)-6-fluoro-4-pyridinyl]oxy]-2-propan-2-ylphenol (PubChem CID 10249469) has the molecular formula C18H19Cl2FN2O2
and a molecular weight of 385.27 g/mol. Its IUPAC name is 4-[[3,5-dichloro-2-(cyclopropylmethylamino)-6-fluoro-4-pyridinyl]oxy]-2-propan-2-ylphenol.
Molecular Properties
| Compound Name | 4-[[3,5-dichloro-2-(cyclopropylmethylamino)-6-fluoro-4-pyridinyl]oxy]-2-propan-2-ylphenol |
| PubChem CID | 10249469 |
| Molecular Formula | C18H19Cl2FN2O2 |
| Molecular Weight | 385.27 g/mol |
| Exact Mass | 384.08 |
| IUPAC Name | 4-[[3,5-dichloro-2-(cyclopropylmethylamino)-6-fluoro-4-pyridinyl]oxy]-2-propan-2-ylphenol |
| SMILES | CC(C)c1cc(Oc2c(Cl)c(F)nc(NCC3CC3)c2Cl)ccc1O |
| InChI | InChI=1S/C18H19Cl2FN2O2/c1-9(2)12-7-11(5-6-13(12)24)25-16-14(19)17(21)23-18(15(16)20)22-8-10-3-4-10/h5-7,9-10,24H,3-4,8H2,1-2H3,(H,22,23) |
| InChIKey | FAXYZVJVZSUTKF-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 54.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 385.27 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 4-[[3,5-dichloro-2-(cyclopropylmethylamino)-6-fluoro-4-pyridinyl]oxy]-2-propan-2-ylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[3,5-dichloro-2-(cyclopropylmethylamino)-6-fluoro-4-pyridinyl]oxy]-2-propan-2-ylphenol?
The IUPAC name of 4-[[3,5-dichloro-2-(cyclopropylmethylamino)-6-fluoro-4-pyridinyl]oxy]-2-propan-2-ylphenol (CID 10249469) is 4-[[3,5-dichloro-2-(cyclopropylmethylamino)-6-fluoro-4-pyridinyl]oxy]-2-propan-2-ylphenol.
What is the SMILES notation for 4-[[3,5-dichloro-2-(cyclopropylmethylamino)-6-fluoro-4-pyridinyl]oxy]-2-propan-2-ylphenol?
The canonical SMILES for 4-[[3,5-dichloro-2-(cyclopropylmethylamino)-6-fluoro-4-pyridinyl]oxy]-2-propan-2-ylphenol is CC(C)c1cc(Oc2c(Cl)c(F)nc(NCC3CC3)c2Cl)ccc1O.
What is the InChIKey of 4-[[3,5-dichloro-2-(cyclopropylmethylamino)-6-fluoro-4-pyridinyl]oxy]-2-propan-2-ylphenol?
The InChIKey is FAXYZVJVZSUTKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19Cl2FN2O2/c1-9(2)12-7-11(5-6-13(12)24)25-16-14(19)17(21)23-18(15(16)20)22-8-10-3-4-10/h5-7,9-10,24H,3-4,8H2,1-2H3,(H,22,23).
What are the key properties of 4-[[3,5-dichloro-2-(cyclopropylmethylamino)-6-fluoro-4-pyridinyl]oxy]-2-propan-2-ylphenol?
4-[[3,5-dichloro-2-(cyclopropylmethylamino)-6-fluoro-4-pyridinyl]oxy]-2-propan-2-ylphenol has a molecular weight of 385.27 g/mol, XLogP of 5.97, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[3,5-dichloro-2-(cyclopropylmethylamino)-6-fluoro-4-pyridinyl]oxy]-2-propan-2-ylphenol is sourced from PubChem (CID 10249469), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).