C22H22O6 — CID 102495295
4,11-bis(2-methoxyethoxy)tetracyclo[6.6.2.02,7.09,14]hexadeca-2(7),3,5,9(14),10,12-hexaene-15,16-dione (PubChem CID 102495295) has the molecular formula C22H22O6 and a molecular weight of 382.41 g/mol. Its IUPAC name is 4,11-bis(2-methoxyethoxy)tetracyclo[6.6.2.02,7.09,14]hexadeca-2(7),3,5,9(14),10,12-hexaene-15,16-dione.
| Compound Name | 4,11-bis(2-methoxyethoxy)tetracyclo[6.6.2.02,7.09,14]hexadeca-2(7),3,5,9(14),10,12-hexaene-15,16-dione |
|---|---|
| PubChem CID | 102495295 |
| Molecular Formula | C22H22O6 |
| Molecular Weight | 382.41 g/mol |
| Exact Mass | 382.14 |
| IUPAC Name | 4,11-bis(2-methoxyethoxy)tetracyclo[6.6.2.02,7.09,14]hexadeca-2(7),3,5,9(14),10,12-hexaene-15,16-dione |
| SMILES | COCCOc1ccc2c(c1)C1C(=O)C(=O)C2c2cc(OCCOC)ccc21 |
| InChI | InChI=1S/C22H22O6/c1-25-7-9-27-13-3-5-15-17(11-13)19-16-6-4-14(28-10-8-26-2)12-18(16)20(15)22(24)21(19)23/h3-6,11-12,19-20H,7-10H2,1-2H3 |
| InChIKey | DFKBMJBREIMIHW-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.41 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|