C9H13NO4S — CID 102495300
ethyl (2Z)-2-[(5S)-3,5-dimethyl-1,4-dioxo-1,3-thiazolidin-2-ylidene]acetate (PubChem CID 102495300) has the molecular formula C9H13NO4S and a molecular weight of 231.27 g/mol. Its IUPAC name is ethyl (2Z)-2-[(5S)-3,5-dimethyl-1,4-dioxo-1,3-thiazolidin-2-ylidene]acetate.
| Compound Name | ethyl (2Z)-2-[(5S)-3,5-dimethyl-1,4-dioxo-1,3-thiazolidin-2-ylidene]acetate |
|---|---|
| PubChem CID | 102495300 |
| Molecular Formula | C9H13NO4S |
| Molecular Weight | 231.27 g/mol |
| Exact Mass | 231.06 |
| IUPAC Name | ethyl (2Z)-2-[(5S)-3,5-dimethyl-1,4-dioxo-1,3-thiazolidin-2-ylidene]acetate |
| SMILES | CCOC(=O)/C=C1/N(C)C(=O)[C@H](C)S1=O |
| InChI | InChI=1S/C9H13NO4S/c1-4-14-8(11)5-7-10(3)9(12)6(2)15(7)13/h5-6H,4H2,1-3H3/b7-5-/t6-,15?/m0/s1 |
| InChIKey | DBDQTTRESPRBOC-JEHCJBGJSA-N |
| XLogP | 0.00 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.27 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|