C38H49N3O6 — CID 102495352
1-butyl-3-[7-[8-(1,4,7,10,13-pentaoxa-16-azacyclooctadec-16-ylmethyl)naphthalen-2-yl]naphthalen-1-yl]urea (PubChem CID 102495352) has the molecular formula C38H49N3O6 and a molecular weight of 643.82 g/mol. Its IUPAC name is 1-butyl-3-[7-[8-(1,4,7,10,13-pentaoxa-16-azacyclooctadec-16-ylmethyl)naphthalen-2-yl]naphthalen-1-yl]urea.
| Compound Name | 1-butyl-3-[7-[8-(1,4,7,10,13-pentaoxa-16-azacyclooctadec-16-ylmethyl)naphthalen-2-yl]naphthalen-1-yl]urea |
|---|---|
| PubChem CID | 102495352 |
| Molecular Formula | C38H49N3O6 |
| Molecular Weight | 643.82 g/mol |
| Exact Mass | 643.36 |
| IUPAC Name | 1-butyl-3-[7-[8-(1,4,7,10,13-pentaoxa-16-azacyclooctadec-16-ylmethyl)naphthalen-2-yl]naphthalen-1-yl]urea |
| SMILES | CCCCNC(=O)Nc1cccc2ccc(-c3ccc4cccc(CN5CCOCCOCCOCCOCCOCC5)c4c3)cc12 |
| InChI | InChI=1S/C38H49N3O6/c1-2-3-14-39-38(42)40-37-9-5-7-31-11-13-33(28-36(31)37)32-12-10-30-6-4-8-34(35(30)27-32)29-41-15-17-43-19-21-45-23-25-47-26-24-46-22-20-44-18-16-41/h4-13,27-28H,2-3,14-26,29H2,1H3,(H2,39,40,42) |
| InChIKey | JWQOZUDPDIAPCE-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 90.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.82 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|