About 6-phenylpyrido[2,3-d]pyridazin-5-one
6-phenylpyrido[2,3-d]pyridazin-5-one (PubChem CID 102495888) has the molecular formula C13H9N3O
and a molecular weight of 223.24 g/mol. Its IUPAC name is 6-phenylpyrido[2,3-d]pyridazin-5-one.
Molecular Properties
| Compound Name | 6-phenylpyrido[2,3-d]pyridazin-5-one |
| PubChem CID | 102495888 |
| Molecular Formula | C13H9N3O |
| Molecular Weight | 223.24 g/mol |
| Exact Mass | 223.07 |
| IUPAC Name | 6-phenylpyrido[2,3-d]pyridazin-5-one |
| SMILES | O=c1c2cccnc2cnn1-c1ccccc1 |
| InChI | InChI=1S/C13H9N3O/c17-13-11-7-4-8-14-12(11)9-15-16(13)10-5-2-1-3-6-10/h1-9H |
| InChIKey | BYLUAXOLPHNZHV-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.24 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-phenylpyrido[2,3-d]pyridazin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-phenylpyrido[2,3-d]pyridazin-5-one?
The IUPAC name of 6-phenylpyrido[2,3-d]pyridazin-5-one (CID 102495888) is 6-phenylpyrido[2,3-d]pyridazin-5-one.
What is the SMILES notation for 6-phenylpyrido[2,3-d]pyridazin-5-one?
The canonical SMILES for 6-phenylpyrido[2,3-d]pyridazin-5-one is O=c1c2cccnc2cnn1-c1ccccc1.
What is the InChIKey of 6-phenylpyrido[2,3-d]pyridazin-5-one?
The InChIKey is BYLUAXOLPHNZHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9N3O/c17-13-11-7-4-8-14-12(11)9-15-16(13)10-5-2-1-3-6-10/h1-9H.
What are the key properties of 6-phenylpyrido[2,3-d]pyridazin-5-one?
6-phenylpyrido[2,3-d]pyridazin-5-one has a molecular weight of 223.24 g/mol, XLogP of 1.78, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-phenylpyrido[2,3-d]pyridazin-5-one is sourced from PubChem (CID 102495888), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).