C19H19FN2O4 — CID 102495981
methyl (E)-2-acetamido-3-(4-fluorophenyl)-3-(4-methoxyanilino)prop-2-enoate (PubChem CID 102495981) has the molecular formula C19H19FN2O4 and a molecular weight of 358.37 g/mol. Its IUPAC name is methyl (E)-2-acetamido-3-(4-fluorophenyl)-3-(4-methoxyanilino)prop-2-enoate.
| Compound Name | methyl (E)-2-acetamido-3-(4-fluorophenyl)-3-(4-methoxyanilino)prop-2-enoate |
|---|---|
| PubChem CID | 102495981 |
| Molecular Formula | C19H19FN2O4 |
| Molecular Weight | 358.37 g/mol |
| Exact Mass | 358.13 |
| IUPAC Name | methyl (E)-2-acetamido-3-(4-fluorophenyl)-3-(4-methoxyanilino)prop-2-enoate |
| SMILES | COC(=O)/C(NC(C)=O)=C(\Nc1ccc(OC)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C19H19FN2O4/c1-12(23)21-18(19(24)26-3)17(13-4-6-14(20)7-5-13)22-15-8-10-16(25-2)11-9-15/h4-11,22H,1-3H3,(H,21,23)/b18-17+ |
| InChIKey | ZBPRVOQGVCFQNO-ISLYRVAYSA-N |
| XLogP | 2.92 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.37 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|