About methyl 4'-hydroxy-1'-(4-methylphenyl)-2,5'-dioxospiro[1H-indole-3,2'-pyrrole]-3'-carboxylate
methyl 4'-hydroxy-1'-(4-methylphenyl)-2,5'-dioxospiro[1H-indole-3,2'-pyrrole]-3'-carboxylate (PubChem CID 102496044) has the molecular formula C20H16N2O5
and a molecular weight of 364.36 g/mol. Its IUPAC name is methyl 4'-hydroxy-1'-(4-methylphenyl)-2,5'-dioxospiro[1H-indole-3,2'-pyrrole]-3'-carboxylate.
Molecular Properties
| Compound Name | methyl 4'-hydroxy-1'-(4-methylphenyl)-2,5'-dioxospiro[1H-indole-3,2'-pyrrole]-3'-carboxylate |
| PubChem CID | 102496044 |
| Molecular Formula | C20H16N2O5 |
| Molecular Weight | 364.36 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | methyl 4'-hydroxy-1'-(4-methylphenyl)-2,5'-dioxospiro[1H-indole-3,2'-pyrrole]-3'-carboxylate |
| SMILES | COC(=O)C1=C(O)C(=O)N(c2ccc(C)cc2)C12C(=O)Nc1ccccc12 |
| InChI | InChI=1S/C20H16N2O5/c1-11-7-9-12(10-8-11)22-17(24)16(23)15(18(25)27-2)20(22)13-5-3-4-6-14(13)21-19(20)26/h3-10,23H,1-2H3,(H,21,26) |
| InChIKey | HKIXFRAXSORLSA-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.36 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 4'-hydroxy-1'-(4-methylphenyl)-2,5'-dioxospiro[1H-indole-3,2'-pyrrole]-3'-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4'-hydroxy-1'-(4-methylphenyl)-2,5'-dioxospiro[1H-indole-3,2'-pyrrole]-3'-carboxylate?
The IUPAC name of methyl 4'-hydroxy-1'-(4-methylphenyl)-2,5'-dioxospiro[1H-indole-3,2'-pyrrole]-3'-carboxylate (CID 102496044) is methyl 4'-hydroxy-1'-(4-methylphenyl)-2,5'-dioxospiro[1H-indole-3,2'-pyrrole]-3'-carboxylate.
What is the SMILES notation for methyl 4'-hydroxy-1'-(4-methylphenyl)-2,5'-dioxospiro[1H-indole-3,2'-pyrrole]-3'-carboxylate?
The canonical SMILES for methyl 4'-hydroxy-1'-(4-methylphenyl)-2,5'-dioxospiro[1H-indole-3,2'-pyrrole]-3'-carboxylate is COC(=O)C1=C(O)C(=O)N(c2ccc(C)cc2)C12C(=O)Nc1ccccc12.
What is the InChIKey of methyl 4'-hydroxy-1'-(4-methylphenyl)-2,5'-dioxospiro[1H-indole-3,2'-pyrrole]-3'-carboxylate?
The InChIKey is HKIXFRAXSORLSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H16N2O5/c1-11-7-9-12(10-8-11)22-17(24)16(23)15(18(25)27-2)20(22)13-5-3-4-6-14(13)21-19(20)26/h3-10,23H,1-2H3,(H,21,26).
What are the key properties of methyl 4'-hydroxy-1'-(4-methylphenyl)-2,5'-dioxospiro[1H-indole-3,2'-pyrrole]-3'-carboxylate?
methyl 4'-hydroxy-1'-(4-methylphenyl)-2,5'-dioxospiro[1H-indole-3,2'-pyrrole]-3'-carboxylate has a molecular weight of 364.36 g/mol, XLogP of 2.17, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4'-hydroxy-1'-(4-methylphenyl)-2,5'-dioxospiro[1H-indole-3,2'-pyrrole]-3'-carboxylate is sourced from PubChem (CID 102496044), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).