C27H21F6NOS — CID 102496346
3-[3,3,4,4,5,5-hexafluoro-2-[5-(3-methoxyphenyl)-2-methylthiophen-3-yl]cyclopenten-1-yl]-1,2-dimethylindole (PubChem CID 102496346) has the molecular formula C27H21F6NOS and a molecular weight of 521.53 g/mol. Its IUPAC name is 3-[3,3,4,4,5,5-hexafluoro-2-[5-(3-methoxyphenyl)-2-methylthiophen-3-yl]cyclopenten-1-yl]-1,2-dimethylindole.
| Compound Name | 3-[3,3,4,4,5,5-hexafluoro-2-[5-(3-methoxyphenyl)-2-methylthiophen-3-yl]cyclopenten-1-yl]-1,2-dimethylindole |
|---|---|
| PubChem CID | 102496346 |
| Molecular Formula | C27H21F6NOS |
| Molecular Weight | 521.53 g/mol |
| Exact Mass | 521.12 |
| IUPAC Name | 3-[3,3,4,4,5,5-hexafluoro-2-[5-(3-methoxyphenyl)-2-methylthiophen-3-yl]cyclopenten-1-yl]-1,2-dimethylindole |
| SMILES | COc1cccc(-c2cc(C3=C(c4c(C)n(C)c5ccccc45)C(F)(F)C(F)(F)C3(F)F)c(C)s2)c1 |
| InChI | InChI=1S/C27H21F6NOS/c1-14-22(18-10-5-6-11-20(18)34(14)3)24-23(25(28,29)27(32,33)26(24,30)31)19-13-21(36-15(19)2)16-8-7-9-17(12-16)35-4/h5-13H,1-4H3 |
| InChIKey | DLZMXTYPKWEQHH-UHFFFAOYSA-N |
| XLogP | 8.36 |
| TPSA | 14.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.53 |
| LogP ≤ 5 | 8.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|