About CID 102496353
CID 102496353 (PubChem CID 102496353) has the molecular formula C28H20N7O4P3
and a molecular weight of 611.44 g/mol.
Molecular Properties
| Compound Name | CID 102496353 |
| PubChem CID | 102496353 |
| Molecular Formula | C28H20N7O4P3 |
| Molecular Weight | 611.44 g/mol |
| Exact Mass | 611.08 |
| IUPAC Name | — |
| SMILES | c1ccc(N2c3ccccc3OP23=NP2(=NP4(=N3)Oc3ccccc3N4c3ccccn3)Oc3ccccc3O2)nc1 |
| InChI | InChI=1S/C28H20N7O4P3/c1-3-13-23-21(11-1)34(27-17-7-9-19-29-27)40(36-23)31-41(33-42(32-40)38-25-15-5-6-16-26(25)39-42)35(28-18-8-10-20-30-28)22-12-2-4-14-24(22)37-41/h1-20H |
| InChIKey | PJBGDJFTBAOOAP-UHFFFAOYSA-N |
| XLogP | 9.56 |
| TPSA | 106.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 42 |
| Complexity | — |
Lipinski Rule of Five
3 violations
| Rule | Value |
| MW ≤ 500 | 611.44 |
| LogP ≤ 5 | 9.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze CID 102496353 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 102496353?
The IUPAC name of CID 102496353 (CID 102496353) is not available.
What is the SMILES notation for CID 102496353?
The canonical SMILES for CID 102496353 is c1ccc(N2c3ccccc3OP23=NP2(=NP4(=N3)Oc3ccccc3N4c3ccccn3)Oc3ccccc3O2)nc1.
What is the InChIKey of CID 102496353?
The InChIKey is PJBGDJFTBAOOAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H20N7O4P3/c1-3-13-23-21(11-1)34(27-17-7-9-19-29-27)40(36-23)31-41(33-42(32-40)38-25-15-5-6-16-26(25)39-42)35(28-18-8-10-20-30-28)22-12-2-4-14-24(22)37-41/h1-20H.
What are the key properties of CID 102496353?
CID 102496353 has a molecular weight of 611.44 g/mol, XLogP of 9.56, 2 rotatable bonds, 0 hydrogen bond donors, and 11 hydrogen bond acceptors.
Where does this data come from?
All data for CID 102496353 is sourced from PubChem (CID 102496353), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).