C17H15FO5S — CID 102496493
2-[(E)-3-ethoxy-3-oxoprop-1-enyl]-6-(4-fluorophenyl)benzenesulfonic acid (PubChem CID 102496493) has the molecular formula C17H15FO5S and a molecular weight of 350.37 g/mol. Its IUPAC name is 2-[(E)-3-ethoxy-3-oxoprop-1-enyl]-6-(4-fluorophenyl)benzenesulfonic acid.
| Compound Name | 2-[(E)-3-ethoxy-3-oxoprop-1-enyl]-6-(4-fluorophenyl)benzenesulfonic acid |
|---|---|
| PubChem CID | 102496493 |
| Molecular Formula | C17H15FO5S |
| Molecular Weight | 350.37 g/mol |
| Exact Mass | 350.06 |
| IUPAC Name | 2-[(E)-3-ethoxy-3-oxoprop-1-enyl]-6-(4-fluorophenyl)benzenesulfonic acid |
| SMILES | CCOC(=O)/C=C/c1cccc(-c2ccc(F)cc2)c1S(=O)(=O)O |
| InChI | InChI=1S/C17H15FO5S/c1-2-23-16(19)11-8-13-4-3-5-15(17(13)24(20,21)22)12-6-9-14(18)10-7-12/h3-11H,2H2,1H3,(H,20,21,22)/b11-8+ |
| InChIKey | QSTSQMPCLAFNLL-DHZHZOJOSA-N |
| XLogP | 3.32 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.37 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|