C27H23F3N2O2 — CID 102496663
2-(4-tert-butylphenoxy)-N-quinolin-8-yl-5-(trifluoromethyl)benzamide (PubChem CID 102496663) has the molecular formula C27H23F3N2O2 and a molecular weight of 464.49 g/mol. Its IUPAC name is 2-(4-tert-butylphenoxy)-N-quinolin-8-yl-5-(trifluoromethyl)benzamide.
| Compound Name | 2-(4-tert-butylphenoxy)-N-quinolin-8-yl-5-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 102496663 |
| Molecular Formula | C27H23F3N2O2 |
| Molecular Weight | 464.49 g/mol |
| Exact Mass | 464.17 |
| IUPAC Name | 2-(4-tert-butylphenoxy)-N-quinolin-8-yl-5-(trifluoromethyl)benzamide |
| SMILES | CC(C)(C)c1ccc(Oc2ccc(C(F)(F)F)cc2C(=O)Nc2cccc3cccnc23)cc1 |
| InChI | InChI=1S/C27H23F3N2O2/c1-26(2,3)18-9-12-20(13-10-18)34-23-14-11-19(27(28,29)30)16-21(23)25(33)32-22-8-4-6-17-7-5-15-31-24(17)22/h4-16H,1-3H3,(H,32,33) |
| InChIKey | DQODRVWDHSFORO-UHFFFAOYSA-N |
| XLogP | 7.60 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.49 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |