C19H12F6N2O2 — CID 102496667
N-quinolin-8-yl-2-(2,2,2-trifluoroethoxy)-5-(trifluoromethyl)benzamide (PubChem CID 102496667) has the molecular formula C19H12F6N2O2 and a molecular weight of 414.31 g/mol. Its IUPAC name is N-quinolin-8-yl-2-(2,2,2-trifluoroethoxy)-5-(trifluoromethyl)benzamide.
| Compound Name | N-quinolin-8-yl-2-(2,2,2-trifluoroethoxy)-5-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 102496667 |
| Molecular Formula | C19H12F6N2O2 |
| Molecular Weight | 414.31 g/mol |
| Exact Mass | 414.08 |
| IUPAC Name | N-quinolin-8-yl-2-(2,2,2-trifluoroethoxy)-5-(trifluoromethyl)benzamide |
| SMILES | O=C(Nc1cccc2cccnc12)c1cc(C(F)(F)F)ccc1OCC(F)(F)F |
| InChI | InChI=1S/C19H12F6N2O2/c20-18(21,22)10-29-15-7-6-12(19(23,24)25)9-13(15)17(28)27-14-5-1-3-11-4-2-8-26-16(11)14/h1-9H,10H2,(H,27,28) |
| InChIKey | GKBJQYOJQPTRCK-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.31 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |