C13H18O5 — CID 102496892
(1S,2R,6R,8R,9S)-4,4-dimethyl-9-prop-2-enyl-3,5,7,12-tetraoxatricyclo[6.4.0.02,6]dodecan-11-one (PubChem CID 102496892) has the molecular formula C13H18O5 and a molecular weight of 254.28 g/mol. Its IUPAC name is (1S,2R,6R,8R,9S)-4,4-dimethyl-9-prop-2-enyl-3,5,7,12-tetraoxatricyclo[6.4.0.02,6]dodecan-11-one.
| Compound Name | (1S,2R,6R,8R,9S)-4,4-dimethyl-9-prop-2-enyl-3,5,7,12-tetraoxatricyclo[6.4.0.02,6]dodecan-11-one |
|---|---|
| PubChem CID | 102496892 |
| Molecular Formula | C13H18O5 |
| Molecular Weight | 254.28 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | (1S,2R,6R,8R,9S)-4,4-dimethyl-9-prop-2-enyl-3,5,7,12-tetraoxatricyclo[6.4.0.02,6]dodecan-11-one |
| SMILES | C=CC[C@H]1CC(=O)O[C@H]2[C@@H]1O[C@@H]1OC(C)(C)O[C@@H]12 |
| InChI | InChI=1S/C13H18O5/c1-4-5-7-6-8(14)15-10-9(7)16-12-11(10)17-13(2,3)18-12/h4,7,9-12H,1,5-6H2,2-3H3/t7-,9+,10-,11+,12+/m0/s1 |
| InChIKey | JHYCPPISLRDWAR-KICMGLQKSA-N |
| XLogP | 1.37 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.28 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|