About ethyl 2-methyl-4-methylsulfonylhepta-2,3-dienoate
ethyl 2-methyl-4-methylsulfonylhepta-2,3-dienoate (PubChem CID 102496918) has the molecular formula C11H18O4S
and a molecular weight of 246.33 g/mol. Its IUPAC name is ethyl 2-methyl-4-methylsulfonylhepta-2,3-dienoate.
Molecular Properties
| Compound Name | ethyl 2-methyl-4-methylsulfonylhepta-2,3-dienoate |
| PubChem CID | 102496918 |
| Molecular Formula | C11H18O4S |
| Molecular Weight | 246.33 g/mol |
| Exact Mass | 246.09 |
| IUPAC Name | ethyl 2-methyl-4-methylsulfonylhepta-2,3-dienoate |
| SMILES | CCCC(=C=C(C)C(=O)OCC)S(C)(=O)=O |
| InChI | InChI=1S/C11H18O4S/c1-5-7-10(16(4,13)14)8-9(3)11(12)15-6-2/h5-7H2,1-4H3 |
| InChIKey | GFRJGKNFMXWPNF-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.33 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-methyl-4-methylsulfonylhepta-2,3-dienoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-methyl-4-methylsulfonylhepta-2,3-dienoate?
The IUPAC name of ethyl 2-methyl-4-methylsulfonylhepta-2,3-dienoate (CID 102496918) is ethyl 2-methyl-4-methylsulfonylhepta-2,3-dienoate.
What is the SMILES notation for ethyl 2-methyl-4-methylsulfonylhepta-2,3-dienoate?
The canonical SMILES for ethyl 2-methyl-4-methylsulfonylhepta-2,3-dienoate is CCCC(=C=C(C)C(=O)OCC)S(C)(=O)=O.
What is the InChIKey of ethyl 2-methyl-4-methylsulfonylhepta-2,3-dienoate?
The InChIKey is GFRJGKNFMXWPNF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18O4S/c1-5-7-10(16(4,13)14)8-9(3)11(12)15-6-2/h5-7H2,1-4H3.
What are the key properties of ethyl 2-methyl-4-methylsulfonylhepta-2,3-dienoate?
ethyl 2-methyl-4-methylsulfonylhepta-2,3-dienoate has a molecular weight of 246.33 g/mol, XLogP of 1.82, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-methyl-4-methylsulfonylhepta-2,3-dienoate is sourced from PubChem (CID 102496918), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).