C23H27NO4 — CID 102497012
tert-butyl (1R,2R,10bS)-1-benzyl-2-hydroxy-1,5,6,10b-tetrahydro-[1,2]oxazolo[3,2-a]isoquinoline-2-carboxylate (PubChem CID 102497012) has the molecular formula C23H27NO4 and a molecular weight of 381.47 g/mol. Its IUPAC name is tert-butyl (1R,2R,10bS)-1-benzyl-2-hydroxy-1,5,6,10b-tetrahydro-[1,2]oxazolo[3,2-a]isoquinoline-2-carboxylate.
| Compound Name | tert-butyl (1R,2R,10bS)-1-benzyl-2-hydroxy-1,5,6,10b-tetrahydro-[1,2]oxazolo[3,2-a]isoquinoline-2-carboxylate |
|---|---|
| PubChem CID | 102497012 |
| Molecular Formula | C23H27NO4 |
| Molecular Weight | 381.47 g/mol |
| Exact Mass | 381.19 |
| IUPAC Name | tert-butyl (1R,2R,10bS)-1-benzyl-2-hydroxy-1,5,6,10b-tetrahydro-[1,2]oxazolo[3,2-a]isoquinoline-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)[C@]1(O)ON2CCc3ccccc3[C@@H]2[C@H]1Cc1ccccc1 |
| InChI | InChI=1S/C23H27NO4/c1-22(2,3)27-21(25)23(26)19(15-16-9-5-4-6-10-16)20-18-12-8-7-11-17(18)13-14-24(20)28-23/h4-12,19-20,26H,13-15H2,1-3H3/t19-,20-,23-/m1/s1 |
| InChIKey | VBHLXGADROGHIE-TXTKFYIRSA-N |
| XLogP | 3.42 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.47 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |