C49H96O6Si4 — CID 102497065
(4S,6S)-4-methyl-6-[(4R,6E,8S,10E,12S,14E,16S)-4,8,12,16-tetrakis(triethylsilyloxy)nonadeca-6,10,14,18-tetraenyl]oxan-2-one (PubChem CID 102497065) has the molecular formula C49H96O6Si4 and a molecular weight of 893.64 g/mol. Its IUPAC name is (4S,6S)-4-methyl-6-[(4R,6E,8S,10E,12S,14E,16S)-4,8,12,16-tetrakis(triethylsilyloxy)nonadeca-6,10,14,18-tetraenyl]oxan-2-one.
| Compound Name | (4S,6S)-4-methyl-6-[(4R,6E,8S,10E,12S,14E,16S)-4,8,12,16-tetrakis(triethylsilyloxy)nonadeca-6,10,14,18-tetraenyl]oxan-2-one |
|---|---|
| PubChem CID | 102497065 |
| Molecular Formula | C49H96O6Si4 |
| Molecular Weight | 893.64 g/mol |
| Exact Mass | 892.63 |
| IUPAC Name | (4S,6S)-4-methyl-6-[(4R,6E,8S,10E,12S,14E,16S)-4,8,12,16-tetrakis(triethylsilyloxy)nonadeca-6,10,14,18-tetraenyl]oxan-2-one |
| SMILES | C=CC[C@@H](/C=C/C[C@@H](/C=C/C[C@@H](/C=C/C[C@@H](CCC[C@H]1C[C@H](C)CC(=O)O1)O[Si](CC)(CC)CC)O[Si](CC)(CC)CC)O[Si](CC)(CC)CC)O[Si](CC)(CC)CC |
| InChI | InChI=1S/C49H96O6Si4/c1-15-32-44(52-56(16-2,17-3)18-4)33-28-34-45(53-57(19-5,20-6)21-7)35-29-36-46(54-58(22-8,23-9)24-10)37-30-38-47(55-59(25-11,26-12)27-13)39-31-40-48-41-43(14)42-49(50)51-48/h15,28-30,33,35,37,43-48H,1,16-27,31-32,34,36,38-42H2,2-14H3/b33-28+,35-29+,37-30+/t43-,44-,45-,46-,47-,48-/m0/s1 |
| InChIKey | QQXBKPSVYSDLKP-XRQIGBMWSA-N |
| XLogP | 15.48 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 893.64 |
| LogP ≤ 5 | 15.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|