C33H62O5Si2 — CID 102497066
(4S,6S)-6-[(4R,6E,8S,10E,12S)-12-hydroxy-4,8-bis(triethylsilyloxy)pentadeca-6,10,14-trienyl]-4-methyloxan-2-one (PubChem CID 102497066) has the molecular formula C33H62O5Si2 and a molecular weight of 595.03 g/mol. Its IUPAC name is (4S,6S)-6-[(4R,6E,8S,10E,12S)-12-hydroxy-4,8-bis(triethylsilyloxy)pentadeca-6,10,14-trienyl]-4-methyloxan-2-one.
| Compound Name | (4S,6S)-6-[(4R,6E,8S,10E,12S)-12-hydroxy-4,8-bis(triethylsilyloxy)pentadeca-6,10,14-trienyl]-4-methyloxan-2-one |
|---|---|
| PubChem CID | 102497066 |
| Molecular Formula | C33H62O5Si2 |
| Molecular Weight | 595.03 g/mol |
| Exact Mass | 594.41 |
| IUPAC Name | (4S,6S)-6-[(4R,6E,8S,10E,12S)-12-hydroxy-4,8-bis(triethylsilyloxy)pentadeca-6,10,14-trienyl]-4-methyloxan-2-one |
| SMILES | C=CC[C@H](O)/C=C/C[C@@H](/C=C/C[C@@H](CCC[C@H]1C[C@H](C)CC(=O)O1)O[Si](CC)(CC)CC)O[Si](CC)(CC)CC |
| InChI | InChI=1S/C33H62O5Si2/c1-9-19-29(34)20-16-21-30(37-39(10-2,11-3)12-4)22-17-23-31(38-40(13-5,14-6)15-7)24-18-25-32-26-28(8)27-33(35)36-32/h9,16-17,20,22,28-32,34H,1,10-15,18-19,21,23-27H2,2-8H3/b20-16+,22-17+/t28-,29-,30-,31-,32-/m0/s1 |
| InChIKey | NNHMMCLLOSKXRP-PQQVOIFOSA-N |
| XLogP | 9.11 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.03 |
| LogP ≤ 5 | 9.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|