C24H35N7O3S5 — CID 102497269
(2S)-2,6-bis[[2-amino-3-(ethyldisulfanyl)propanoyl]amino]-N-(2-cyano-1,3-benzothiazol-6-yl)hexanamide (PubChem CID 102497269) has the molecular formula C24H35N7O3S5 and a molecular weight of 629.93 g/mol. Its IUPAC name is (2S)-2,6-bis[[2-amino-3-(ethyldisulfanyl)propanoyl]amino]-N-(2-cyano-1,3-benzothiazol-6-yl)hexanamide.
| Compound Name | (2S)-2,6-bis[[2-amino-3-(ethyldisulfanyl)propanoyl]amino]-N-(2-cyano-1,3-benzothiazol-6-yl)hexanamide |
|---|---|
| PubChem CID | 102497269 |
| Molecular Formula | C24H35N7O3S5 |
| Molecular Weight | 629.93 g/mol |
| Exact Mass | 629.14 |
| IUPAC Name | (2S)-2,6-bis[[2-amino-3-(ethyldisulfanyl)propanoyl]amino]-N-(2-cyano-1,3-benzothiazol-6-yl)hexanamide |
| SMILES | CCSSCC(N)C(=O)NCCCC[C@H](NC(=O)C(N)CSSCC)C(=O)Nc1ccc2nc(C#N)sc2c1 |
| InChI | InChI=1S/C24H35N7O3S5/c1-3-35-37-13-16(26)22(32)28-10-6-5-7-19(31-23(33)17(27)14-38-36-4-2)24(34)29-15-8-9-18-20(11-15)39-21(12-25)30-18/h8-9,11,16-17,19H,3-7,10,13-14,26-27H2,1-2H3,(H,28,32)(H,29,34)(H,31,33)/t16?,17?,19-/m0/s1 |
| InChIKey | UVXFUXGACAKNOK-TVPLGVNVSA-N |
| XLogP | 3.33 |
| TPSA | 176.02 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.93 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|