C16H34B2O4Si — CID 102497336
bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl-trimethylsilane (PubChem CID 102497336) has the molecular formula C16H34B2O4Si and a molecular weight of 340.15 g/mol. Its IUPAC name is bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl-trimethylsilane.
| Compound Name | bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl-trimethylsilane |
|---|---|
| PubChem CID | 102497336 |
| Molecular Formula | C16H34B2O4Si |
| Molecular Weight | 340.15 g/mol |
| Exact Mass | 340.24 |
| IUPAC Name | bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl-trimethylsilane |
| SMILES | CC1(C)OB(C(B2OC(C)(C)C(C)(C)O2)[Si](C)(C)C)OC1(C)C |
| InChI | InChI=1S/C16H34B2O4Si/c1-13(2)14(3,4)20-17(19-13)12(23(9,10)11)18-21-15(5,6)16(7,8)22-18/h12H,1-11H3 |
| InChIKey | IJGSEWTYRWXJFH-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.15 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|