C13H24O5Si — CID 102497449
(1S,4R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-1,4-dihydroxycyclohex-2-ene-1-carboxylic acid (PubChem CID 102497449) has the molecular formula C13H24O5Si and a molecular weight of 288.42 g/mol. Its IUPAC name is (1S,4R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-1,4-dihydroxycyclohex-2-ene-1-carboxylic acid.
| Compound Name | (1S,4R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-1,4-dihydroxycyclohex-2-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 102497449 |
| Molecular Formula | C13H24O5Si |
| Molecular Weight | 288.42 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | (1S,4R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-1,4-dihydroxycyclohex-2-ene-1-carboxylic acid |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1C[C@@](O)(C(=O)O)C=C[C@H]1O |
| InChI | InChI=1S/C13H24O5Si/c1-12(2,3)19(4,5)18-10-8-13(17,11(15)16)7-6-9(10)14/h6-7,9-10,14,17H,8H2,1-5H3,(H,15,16)/t9-,10-,13-/m1/s1 |
| InChIKey | OTKZCIMWXBXALQ-GIPNMCIBSA-N |
| XLogP | 1.51 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.42 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|