C14H22N2O2 — CID 102497520
(2S,7aS)-2-ethyl-N,N,4-trimethyl-5-oxo-3,6,7,7a-tetrahydro-2H-indole-1-carboxamide (PubChem CID 102497520) has the molecular formula C14H22N2O2 and a molecular weight of 250.34 g/mol. Its IUPAC name is (2S,7aS)-2-ethyl-N,N,4-trimethyl-5-oxo-3,6,7,7a-tetrahydro-2H-indole-1-carboxamide.
| Compound Name | (2S,7aS)-2-ethyl-N,N,4-trimethyl-5-oxo-3,6,7,7a-tetrahydro-2H-indole-1-carboxamide |
|---|---|
| PubChem CID | 102497520 |
| Molecular Formula | C14H22N2O2 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.17 |
| IUPAC Name | (2S,7aS)-2-ethyl-N,N,4-trimethyl-5-oxo-3,6,7,7a-tetrahydro-2H-indole-1-carboxamide |
| SMILES | CC[C@H]1CC2=C(C)C(=O)CC[C@@H]2N1C(=O)N(C)C |
| InChI | InChI=1S/C14H22N2O2/c1-5-10-8-11-9(2)13(17)7-6-12(11)16(10)14(18)15(3)4/h10,12H,5-8H2,1-4H3/t10-,12-/m0/s1 |
| InChIKey | VUVCRLYHLBDQIN-JQWIXIFHSA-N |
| XLogP | 2.20 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |