C18H36S3 — CID 102497626
[1,3,5-tripropyl-3,5-bis(sulfanylmethyl)cyclohexyl]methanethiol (PubChem CID 102497626) has the molecular formula C18H36S3 and a molecular weight of 348.69 g/mol. Its IUPAC name is [1,3,5-tripropyl-3,5-bis(sulfanylmethyl)cyclohexyl]methanethiol.
| Compound Name | [1,3,5-tripropyl-3,5-bis(sulfanylmethyl)cyclohexyl]methanethiol |
|---|---|
| PubChem CID | 102497626 |
| Molecular Formula | C18H36S3 |
| Molecular Weight | 348.69 g/mol |
| Exact Mass | 348.20 |
| IUPAC Name | [1,3,5-tripropyl-3,5-bis(sulfanylmethyl)cyclohexyl]methanethiol |
| SMILES | CCCC1(CS)CC(CS)(CCC)CC(CS)(CCC)C1 |
| InChI | InChI=1S/C18H36S3/c1-4-7-16(13-19)10-17(14-20,8-5-2)12-18(11-16,15-21)9-6-3/h19-21H,4-15H2,1-3H3 |
| InChIKey | NIEIWROOCOCODY-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.69 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|