C20H20ClNO3S — CID 10249774
3-(3-chlorophenyl)-4-(4-methylsulfonylphenyl)-1-propyl-2H-pyrrol-5-one (PubChem CID 10249774) has the molecular formula C20H20ClNO3S and a molecular weight of 389.90 g/mol. Its IUPAC name is 3-(3-chlorophenyl)-4-(4-methylsulfonylphenyl)-1-propyl-2H-pyrrol-5-one.
| Compound Name | 3-(3-chlorophenyl)-4-(4-methylsulfonylphenyl)-1-propyl-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 10249774 |
| Molecular Formula | C20H20ClNO3S |
| Molecular Weight | 389.90 g/mol |
| Exact Mass | 389.09 |
| IUPAC Name | 3-(3-chlorophenyl)-4-(4-methylsulfonylphenyl)-1-propyl-2H-pyrrol-5-one |
| SMILES | CCCN1CC(c2cccc(Cl)c2)=C(c2ccc(S(C)(=O)=O)cc2)C1=O |
| InChI | InChI=1S/C20H20ClNO3S/c1-3-11-22-13-18(15-5-4-6-16(21)12-15)19(20(22)23)14-7-9-17(10-8-14)26(2,24)25/h4-10,12H,3,11,13H2,1-2H3 |
| InChIKey | QEOCRHOVLIGLJF-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.90 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|