C23H26N4O2 — CID 10249816
N-[3-(dimethylamino)propyl]-9-hydroxy-5,6-dimethylpyrido[4,3-b]carbazole-1-carboxamide (PubChem CID 10249816) has the molecular formula C23H26N4O2 and a molecular weight of 390.49 g/mol. Its IUPAC name is N-[3-(dimethylamino)propyl]-9-hydroxy-5,6-dimethylpyrido[4,3-b]carbazole-1-carboxamide.
| Compound Name | N-[3-(dimethylamino)propyl]-9-hydroxy-5,6-dimethylpyrido[4,3-b]carbazole-1-carboxamide |
|---|---|
| PubChem CID | 10249816 |
| Molecular Formula | C23H26N4O2 |
| Molecular Weight | 390.49 g/mol |
| Exact Mass | 390.21 |
| IUPAC Name | N-[3-(dimethylamino)propyl]-9-hydroxy-5,6-dimethylpyrido[4,3-b]carbazole-1-carboxamide |
| SMILES | Cc1c2ccnc(C(=O)NCCCN(C)C)c2cc2c3cc(O)ccc3n(C)c12 |
| InChI | InChI=1S/C23H26N4O2/c1-14-16-8-10-24-21(23(29)25-9-5-11-26(2)3)18(16)13-19-17-12-15(28)6-7-20(17)27(4)22(14)19/h6-8,10,12-13,28H,5,9,11H2,1-4H3,(H,25,29) |
| InChIKey | XTNHPYASATZYFN-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 70.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.49 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|