C29H31N3O — CID 102498583
(Z)-2-[[1,3-bis(2,4,6-trimethylphenyl)imidazol-2-ylidene]amino]-1-phenylethenol (PubChem CID 102498583) has the molecular formula C29H31N3O and a molecular weight of 437.59 g/mol. Its IUPAC name is (Z)-2-[[1,3-bis(2,4,6-trimethylphenyl)imidazol-2-ylidene]amino]-1-phenylethenol.
| Compound Name | (Z)-2-[[1,3-bis(2,4,6-trimethylphenyl)imidazol-2-ylidene]amino]-1-phenylethenol |
|---|---|
| PubChem CID | 102498583 |
| Molecular Formula | C29H31N3O |
| Molecular Weight | 437.59 g/mol |
| Exact Mass | 437.25 |
| IUPAC Name | (Z)-2-[[1,3-bis(2,4,6-trimethylphenyl)imidazol-2-ylidene]amino]-1-phenylethenol |
| SMILES | Cc1cc(C)c(-n2ccn(-c3c(C)cc(C)cc3C)c2=N/C=C(\O)c2ccccc2)c(C)c1 |
| InChI | InChI=1S/C29H31N3O/c1-19-14-21(3)27(22(4)15-19)31-12-13-32(28-23(5)16-20(2)17-24(28)6)29(31)30-18-26(33)25-10-8-7-9-11-25/h7-18,33H,1-6H3/b26-18- |
| InChIKey | REDGTBAECRNBPC-ITYLOYPMSA-N |
| XLogP | 6.58 |
| TPSA | 42.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.59 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|