C32H19N5O3 — CID 102498972
4-(4-methylphenyl)-24-(4-nitrophenyl)-3-oxa-5,14,19,20-tetrazahexacyclo[11.11.0.02,6.07,12.015,23.018,22]tetracosa-1(24),2(6),4,7,9,11,13,15(23),16,18(22),20-undecaene (PubChem CID 102498972) has the molecular formula C32H19N5O3 and a molecular weight of 521.54 g/mol. Its IUPAC name is 4-(4-methylphenyl)-24-(4-nitrophenyl)-3-oxa-5,14,19,20-tetrazahexacyclo[11.11.0.02,6.07,12.015,23.018,22]tetracosa-1(24),2(6),4,7,9,11,13,15(23),16,18(22),20-undecaene.
| Compound Name | 4-(4-methylphenyl)-24-(4-nitrophenyl)-3-oxa-5,14,19,20-tetrazahexacyclo[11.11.0.02,6.07,12.015,23.018,22]tetracosa-1(24),2(6),4,7,9,11,13,15(23),16,18(22),20-undecaene |
|---|---|
| PubChem CID | 102498972 |
| Molecular Formula | C32H19N5O3 |
| Molecular Weight | 521.54 g/mol |
| Exact Mass | 521.15 |
| IUPAC Name | 4-(4-methylphenyl)-24-(4-nitrophenyl)-3-oxa-5,14,19,20-tetrazahexacyclo[11.11.0.02,6.07,12.015,23.018,22]tetracosa-1(24),2(6),4,7,9,11,13,15(23),16,18(22),20-undecaene |
| SMILES | Cc1ccc(-c2nc3c4ccccc4c4nc5ccc6[nH]ncc6c5c(-c5ccc([N+](=O)[O-])cc5)c4c3o2)cc1 |
| InChI | InChI=1S/C32H19N5O3/c1-17-6-8-19(9-7-17)32-35-30-22-5-3-2-4-21(22)29-28(31(30)40-32)26(18-10-12-20(13-11-18)37(38)39)27-23-16-33-36-24(23)14-15-25(27)34-29/h2-16H,1H3,(H,33,36) |
| InChIKey | WHZWAZDTHCYXAE-UHFFFAOYSA-N |
| XLogP | 8.11 |
| TPSA | 110.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.54 |
| LogP ≤ 5 | 8.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|