About 4-[(7-chloroquinolin-4-yl)amino]-6-(diethylaminomethyl)-2,3-difluorophenol
4-[(7-chloroquinolin-4-yl)amino]-6-(diethylaminomethyl)-2,3-difluorophenol (PubChem CID 10249914) has the molecular formula C20H20ClF2N3O
and a molecular weight of 391.85 g/mol. Its IUPAC name is 4-[(7-chloroquinolin-4-yl)amino]-6-(diethylaminomethyl)-2,3-difluorophenol.
Molecular Properties
| Compound Name | 4-[(7-chloroquinolin-4-yl)amino]-6-(diethylaminomethyl)-2,3-difluorophenol |
| PubChem CID | 10249914 |
| Molecular Formula | C20H20ClF2N3O |
| Molecular Weight | 391.85 g/mol |
| Exact Mass | 391.13 |
| IUPAC Name | 4-[(7-chloroquinolin-4-yl)amino]-6-(diethylaminomethyl)-2,3-difluorophenol |
| SMILES | CCN(CC)Cc1cc(Nc2ccnc3cc(Cl)ccc23)c(F)c(F)c1O |
| InChI | InChI=1S/C20H20ClF2N3O/c1-3-26(4-2)11-12-9-17(18(22)19(23)20(12)27)25-15-7-8-24-16-10-13(21)5-6-14(15)16/h5-10,27H,3-4,11H2,1-2H3,(H,24,25) |
| InChIKey | RAPIMOUJVAFMOT-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 48.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 391.85 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze 4-[(7-chloroquinolin-4-yl)amino]-6-(diethylaminomethyl)-2,3-difluorophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(7-chloroquinolin-4-yl)amino]-6-(diethylaminomethyl)-2,3-difluorophenol?
The IUPAC name of 4-[(7-chloroquinolin-4-yl)amino]-6-(diethylaminomethyl)-2,3-difluorophenol (CID 10249914) is 4-[(7-chloroquinolin-4-yl)amino]-6-(diethylaminomethyl)-2,3-difluorophenol.
What is the SMILES notation for 4-[(7-chloroquinolin-4-yl)amino]-6-(diethylaminomethyl)-2,3-difluorophenol?
The canonical SMILES for 4-[(7-chloroquinolin-4-yl)amino]-6-(diethylaminomethyl)-2,3-difluorophenol is CCN(CC)Cc1cc(Nc2ccnc3cc(Cl)ccc23)c(F)c(F)c1O.
What is the InChIKey of 4-[(7-chloroquinolin-4-yl)amino]-6-(diethylaminomethyl)-2,3-difluorophenol?
The InChIKey is RAPIMOUJVAFMOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H20ClF2N3O/c1-3-26(4-2)11-12-9-17(18(22)19(23)20(12)27)25-15-7-8-24-16-10-13(21)5-6-14(15)16/h5-10,27H,3-4,11H2,1-2H3,(H,24,25).
What are the key properties of 4-[(7-chloroquinolin-4-yl)amino]-6-(diethylaminomethyl)-2,3-difluorophenol?
4-[(7-chloroquinolin-4-yl)amino]-6-(diethylaminomethyl)-2,3-difluorophenol has a molecular weight of 391.85 g/mol, XLogP of 5.46, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(7-chloroquinolin-4-yl)amino]-6-(diethylaminomethyl)-2,3-difluorophenol is sourced from PubChem (CID 10249914), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).