About CID 102499230
CID 102499230 (PubChem CID 102499230) has the molecular formula C18H28Br2O2SZn-
and a molecular weight of 533.69 g/mol.
Molecular Properties
| Compound Name | CID 102499230 |
| PubChem CID | 102499230 |
| Molecular Formula | C18H28Br2O2SZn- |
| Molecular Weight | 533.69 g/mol |
| Exact Mass | 529.95 |
| IUPAC Name | — |
| SMILES | CC(=O)OCCCCCCCCCCCCc1c[c]sc1Br.[Br-].[Zn] |
| InChI | InChI=1S/C18H28BrO2S.BrH.Zn/c1-16(20)21-14-11-9-7-5-3-2-4-6-8-10-12-17-13-15-22-18(17)19;;/h13H,2-12,14H2,1H3;1H;/p-1 |
| InChIKey | UMEJQEJYQLNILI-UHFFFAOYSA-M |
| XLogP | 3.32 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 533.69 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 102499230 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 102499230?
The IUPAC name of CID 102499230 (CID 102499230) is not available.
What is the SMILES notation for CID 102499230?
The canonical SMILES for CID 102499230 is CC(=O)OCCCCCCCCCCCCc1c[c]sc1Br.[Br-].[Zn].
What is the InChIKey of CID 102499230?
The InChIKey is UMEJQEJYQLNILI-UHFFFAOYSA-M. The full InChI is InChI=1S/C18H28BrO2S.BrH.Zn/c1-16(20)21-14-11-9-7-5-3-2-4-6-8-10-12-17-13-15-22-18(17)19;;/h13H,2-12,14H2,1H3;1H;/p-1.
What are the key properties of CID 102499230?
CID 102499230 has a molecular weight of 533.69 g/mol, XLogP of 3.32, 13 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 102499230 is sourced from PubChem (CID 102499230), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).