About [1-methyl-2-oxo-3-(2,2,2-trifluoroethyl)indol-3-yl]methyl acetate
[1-methyl-2-oxo-3-(2,2,2-trifluoroethyl)indol-3-yl]methyl acetate (PubChem CID 102499449) has the molecular formula C14H14F3NO3
and a molecular weight of 301.26 g/mol. Its IUPAC name is [1-methyl-2-oxo-3-(2,2,2-trifluoroethyl)indol-3-yl]methyl acetate.
Molecular Properties
| Compound Name | [1-methyl-2-oxo-3-(2,2,2-trifluoroethyl)indol-3-yl]methyl acetate |
| PubChem CID | 102499449 |
| Molecular Formula | C14H14F3NO3 |
| Molecular Weight | 301.26 g/mol |
| Exact Mass | 301.09 |
| IUPAC Name | [1-methyl-2-oxo-3-(2,2,2-trifluoroethyl)indol-3-yl]methyl acetate |
| SMILES | CC(=O)OCC1(CC(F)(F)F)C(=O)N(C)c2ccccc21 |
| InChI | InChI=1S/C14H14F3NO3/c1-9(19)21-8-13(7-14(15,16)17)10-5-3-4-6-11(10)18(2)12(13)20/h3-6H,7-8H2,1-2H3 |
| InChIKey | HPQQXOQJEQTSQI-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.26 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [1-methyl-2-oxo-3-(2,2,2-trifluoroethyl)indol-3-yl]methyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-methyl-2-oxo-3-(2,2,2-trifluoroethyl)indol-3-yl]methyl acetate?
The IUPAC name of [1-methyl-2-oxo-3-(2,2,2-trifluoroethyl)indol-3-yl]methyl acetate (CID 102499449) is [1-methyl-2-oxo-3-(2,2,2-trifluoroethyl)indol-3-yl]methyl acetate.
What is the SMILES notation for [1-methyl-2-oxo-3-(2,2,2-trifluoroethyl)indol-3-yl]methyl acetate?
The canonical SMILES for [1-methyl-2-oxo-3-(2,2,2-trifluoroethyl)indol-3-yl]methyl acetate is CC(=O)OCC1(CC(F)(F)F)C(=O)N(C)c2ccccc21.
What is the InChIKey of [1-methyl-2-oxo-3-(2,2,2-trifluoroethyl)indol-3-yl]methyl acetate?
The InChIKey is HPQQXOQJEQTSQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14F3NO3/c1-9(19)21-8-13(7-14(15,16)17)10-5-3-4-6-11(10)18(2)12(13)20/h3-6H,7-8H2,1-2H3.
What are the key properties of [1-methyl-2-oxo-3-(2,2,2-trifluoroethyl)indol-3-yl]methyl acetate?
[1-methyl-2-oxo-3-(2,2,2-trifluoroethyl)indol-3-yl]methyl acetate has a molecular weight of 301.26 g/mol, XLogP of 2.42, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [1-methyl-2-oxo-3-(2,2,2-trifluoroethyl)indol-3-yl]methyl acetate is sourced from PubChem (CID 102499449), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).