C35H36O6S — CID 102499854
(2R,3S,4R,4aS,10bR)-7-methyl-3,4-bis(phenylmethoxy)-2-(phenylmethoxymethyl)-2,3,4,4a,5,10b-hexahydrothiochromeno[4,3-b]pyran 6,6-dioxide (PubChem CID 102499854) has the molecular formula C35H36O6S and a molecular weight of 584.73 g/mol. Its IUPAC name is (2R,3S,4R,4aS,10bR)-7-methyl-3,4-bis(phenylmethoxy)-2-(phenylmethoxymethyl)-2,3,4,4a,5,10b-hexahydrothiochromeno[4,3-b]pyran 6,6-dioxide.
| Compound Name | (2R,3S,4R,4aS,10bR)-7-methyl-3,4-bis(phenylmethoxy)-2-(phenylmethoxymethyl)-2,3,4,4a,5,10b-hexahydrothiochromeno[4,3-b]pyran 6,6-dioxide |
|---|---|
| PubChem CID | 102499854 |
| Molecular Formula | C35H36O6S |
| Molecular Weight | 584.73 g/mol |
| Exact Mass | 584.22 |
| IUPAC Name | (2R,3S,4R,4aS,10bR)-7-methyl-3,4-bis(phenylmethoxy)-2-(phenylmethoxymethyl)-2,3,4,4a,5,10b-hexahydrothiochromeno[4,3-b]pyran 6,6-dioxide |
| SMILES | Cc1cccc2c1S(=O)(=O)C[C@@H]1[C@@H](OCc3ccccc3)[C@H](OCc3ccccc3)[C@@H](COCc3ccccc3)O[C@@H]21 |
| InChI | InChI=1S/C35H36O6S/c1-25-12-11-19-29-32-30(24-42(36,37)35(25)29)33(39-21-27-15-7-3-8-16-27)34(40-22-28-17-9-4-10-18-28)31(41-32)23-38-20-26-13-5-2-6-14-26/h2-19,30-34H,20-24H2,1H3/t30-,31+,32-,33+,34+/m0/s1 |
| InChIKey | GGGSHFHKCQXIRH-IWJWPENGSA-N |
| XLogP | 6.23 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.73 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |