C38H42O6S — CID 102499855
(2R,3S,4R,4aS,10bR)-9-tert-butyl-3,4-bis(phenylmethoxy)-2-(phenylmethoxymethyl)-2,3,4,4a,5,10b-hexahydrothiochromeno[4,3-b]pyran 6,6-dioxide (PubChem CID 102499855) has the molecular formula C38H42O6S and a molecular weight of 626.82 g/mol. Its IUPAC name is (2R,3S,4R,4aS,10bR)-9-tert-butyl-3,4-bis(phenylmethoxy)-2-(phenylmethoxymethyl)-2,3,4,4a,5,10b-hexahydrothiochromeno[4,3-b]pyran 6,6-dioxide.
| Compound Name | (2R,3S,4R,4aS,10bR)-9-tert-butyl-3,4-bis(phenylmethoxy)-2-(phenylmethoxymethyl)-2,3,4,4a,5,10b-hexahydrothiochromeno[4,3-b]pyran 6,6-dioxide |
|---|---|
| PubChem CID | 102499855 |
| Molecular Formula | C38H42O6S |
| Molecular Weight | 626.82 g/mol |
| Exact Mass | 626.27 |
| IUPAC Name | (2R,3S,4R,4aS,10bR)-9-tert-butyl-3,4-bis(phenylmethoxy)-2-(phenylmethoxymethyl)-2,3,4,4a,5,10b-hexahydrothiochromeno[4,3-b]pyran 6,6-dioxide |
| SMILES | CC(C)(C)c1ccc2c(c1)[C@@H]1O[C@H](COCc3ccccc3)[C@@H](OCc3ccccc3)[C@H](OCc3ccccc3)[C@H]1CS2(=O)=O |
| InChI | InChI=1S/C38H42O6S/c1-38(2,3)30-19-20-34-31(21-30)35-32(26-45(34,39)40)36(42-23-28-15-9-5-10-16-28)37(43-24-29-17-11-6-12-18-29)33(44-35)25-41-22-27-13-7-4-8-14-27/h4-21,32-33,35-37H,22-26H2,1-3H3/t32-,33+,35-,36+,37+/m0/s1 |
| InChIKey | XQPGLZYYVANGHO-OJOYEBPYSA-N |
| XLogP | 7.22 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.82 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |