About (1S)-7-(4-methylphenyl)-8-phenylbicyclo[4.2.1]nona-2,4,7-triene
(1S)-7-(4-methylphenyl)-8-phenylbicyclo[4.2.1]nona-2,4,7-triene (PubChem CID 102499927) has the molecular formula C22H20
and a molecular weight of 284.40 g/mol. Its IUPAC name is (1S)-7-(4-methylphenyl)-8-phenylbicyclo[4.2.1]nona-2,4,7-triene.
Molecular Properties
| Compound Name | (1S)-7-(4-methylphenyl)-8-phenylbicyclo[4.2.1]nona-2,4,7-triene |
| PubChem CID | 102499927 |
| Molecular Formula | C22H20 |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | (1S)-7-(4-methylphenyl)-8-phenylbicyclo[4.2.1]nona-2,4,7-triene |
| SMILES | Cc1ccc(C2=C(c3ccccc3)[C@@H]3C=CC=CC2C3)cc1 |
| InChI | InChI=1S/C22H20/c1-16-11-13-18(14-12-16)22-20-10-6-5-9-19(15-20)21(22)17-7-3-2-4-8-17/h2-14,19-20H,15H2,1H3/t19-,20?/m1/s1 |
| InChIKey | AAPJEHOAULEJBV-FIWHBWSRSA-N |
| XLogP | 5.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze (1S)-7-(4-methylphenyl)-8-phenylbicyclo[4.2.1]nona-2,4,7-triene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S)-7-(4-methylphenyl)-8-phenylbicyclo[4.2.1]nona-2,4,7-triene?
The IUPAC name of (1S)-7-(4-methylphenyl)-8-phenylbicyclo[4.2.1]nona-2,4,7-triene (CID 102499927) is (1S)-7-(4-methylphenyl)-8-phenylbicyclo[4.2.1]nona-2,4,7-triene.
What is the SMILES notation for (1S)-7-(4-methylphenyl)-8-phenylbicyclo[4.2.1]nona-2,4,7-triene?
The canonical SMILES for (1S)-7-(4-methylphenyl)-8-phenylbicyclo[4.2.1]nona-2,4,7-triene is Cc1ccc(C2=C(c3ccccc3)[C@@H]3C=CC=CC2C3)cc1.
What is the InChIKey of (1S)-7-(4-methylphenyl)-8-phenylbicyclo[4.2.1]nona-2,4,7-triene?
The InChIKey is AAPJEHOAULEJBV-FIWHBWSRSA-N. The full InChI is InChI=1S/C22H20/c1-16-11-13-18(14-12-16)22-20-10-6-5-9-19(15-20)21(22)17-7-3-2-4-8-17/h2-14,19-20H,15H2,1H3/t19-,20?/m1/s1.
What are the key properties of (1S)-7-(4-methylphenyl)-8-phenylbicyclo[4.2.1]nona-2,4,7-triene?
(1S)-7-(4-methylphenyl)-8-phenylbicyclo[4.2.1]nona-2,4,7-triene has a molecular weight of 284.40 g/mol, XLogP of 5.67, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (1S)-7-(4-methylphenyl)-8-phenylbicyclo[4.2.1]nona-2,4,7-triene is sourced from PubChem (CID 102499927), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).