C25H39N7 — CID 102500303
2,6-bis(1-octyltriazol-4-yl)pyridine (PubChem CID 102500303) has the molecular formula C25H39N7 and a molecular weight of 437.64 g/mol. Its IUPAC name is 2,6-bis(1-octyltriazol-4-yl)pyridine.
| Compound Name | 2,6-bis(1-octyltriazol-4-yl)pyridine |
|---|---|
| PubChem CID | 102500303 |
| Molecular Formula | C25H39N7 |
| Molecular Weight | 437.64 g/mol |
| Exact Mass | 437.33 |
| IUPAC Name | 2,6-bis(1-octyltriazol-4-yl)pyridine |
| SMILES | CCCCCCCCn1cc(-c2cccc(-c3cn(CCCCCCCC)nn3)n2)nn1 |
| InChI | InChI=1S/C25H39N7/c1-3-5-7-9-11-13-18-31-20-24(27-29-31)22-16-15-17-23(26-22)25-21-32(30-28-25)19-14-12-10-8-6-4-2/h15-17,20-21H,3-14,18-19H2,1-2H3 |
| InChIKey | VVFOWGMLHUQDFN-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 74.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.64 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|