C14H30N6O2 — CID 102500632
3,13-dioxa-1,5,8,11,15,18-hexazatricyclo[14.4.1.16,11]docosane (PubChem CID 102500632) has the molecular formula C14H30N6O2 and a molecular weight of 314.43 g/mol. Its IUPAC name is 3,13-dioxa-1,5,8,11,15,18-hexazatricyclo[14.4.1.16,11]docosane.
| Compound Name | 3,13-dioxa-1,5,8,11,15,18-hexazatricyclo[14.4.1.16,11]docosane |
|---|---|
| PubChem CID | 102500632 |
| Molecular Formula | C14H30N6O2 |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.24 |
| IUPAC Name | 3,13-dioxa-1,5,8,11,15,18-hexazatricyclo[14.4.1.16,11]docosane |
| SMILES | C1CN2COCNC3CNCCN(COCNC(CN1)C2)C3 |
| InChI | InChI=1S/C14H30N6O2/c1-3-19-7-13(5-15-1)17-9-22-12-20-4-2-16-6-14(8-20)18-10-21-11-19/h13-18H,1-12H2 |
| InChIKey | DXVOHCPVANEEJU-UHFFFAOYSA-N |
| XLogP | -2.41 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | -2.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |