About triethoxygermane
triethoxygermane (PubChem CID 102500770) has the molecular formula C6H16GeO3
and a molecular weight of 208.80 g/mol. Its IUPAC name is triethoxygermane.
Molecular Properties
| Compound Name | triethoxygermane |
| PubChem CID | 102500770 |
| Molecular Formula | C6H16GeO3 |
| Molecular Weight | 208.80 g/mol |
| Exact Mass | 210.03 |
| IUPAC Name | triethoxygermane |
| SMILES | CCO[GeH](OCC)OCC |
| InChI | InChI=1S/C6H16GeO3/c1-4-8-7(9-5-2)10-6-3/h7H,4-6H2,1-3H3 |
| InChIKey | BRUMYQFENIHSKF-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.80 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze triethoxygermane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of triethoxygermane?
The IUPAC name of triethoxygermane (CID 102500770) is triethoxygermane.
What is the SMILES notation for triethoxygermane?
The canonical SMILES for triethoxygermane is CCO[GeH](OCC)OCC.
What is the InChIKey of triethoxygermane?
The InChIKey is BRUMYQFENIHSKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H16GeO3/c1-4-8-7(9-5-2)10-6-3/h7H,4-6H2,1-3H3.
What are the key properties of triethoxygermane?
triethoxygermane has a molecular weight of 208.80 g/mol, XLogP of 0.81, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for triethoxygermane is sourced from PubChem (CID 102500770), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).