C15H9NO2 — CID 102501606
16-oxa-11-azatetracyclo[8.7.0.03,8.011,15]heptadeca-1,3,5,7,9,12,14-heptaen-17-one (PubChem CID 102501606) has the molecular formula C15H9NO2 and a molecular weight of 235.24 g/mol. Its IUPAC name is 16-oxa-11-azatetracyclo[8.7.0.03,8.011,15]heptadeca-1,3,5,7,9,12,14-heptaen-17-one.
| Compound Name | 16-oxa-11-azatetracyclo[8.7.0.03,8.011,15]heptadeca-1,3,5,7,9,12,14-heptaen-17-one |
|---|---|
| PubChem CID | 102501606 |
| Molecular Formula | C15H9NO2 |
| Molecular Weight | 235.24 g/mol |
| Exact Mass | 235.06 |
| IUPAC Name | 16-oxa-11-azatetracyclo[8.7.0.03,8.011,15]heptadeca-1,3,5,7,9,12,14-heptaen-17-one |
| SMILES | O=c1oc2cccn2c2cc3ccccc3cc12 |
| InChI | InChI=1S/C15H9NO2/c17-15-12-8-10-4-1-2-5-11(10)9-13(12)16-7-3-6-14(16)18-15/h1-9H |
| InChIKey | FLDPLSVHCIAKHV-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 34.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.24 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|