C9H10N2O3 — CID 102501631
5-ethyl-7,8-dihydrofuro[2,3-e][1,3]diazepine-4,6-dione (PubChem CID 102501631) has the molecular formula C9H10N2O3 and a molecular weight of 194.19 g/mol. Its IUPAC name is 5-ethyl-7,8-dihydrofuro[2,3-e][1,3]diazepine-4,6-dione.
| Compound Name | 5-ethyl-7,8-dihydrofuro[2,3-e][1,3]diazepine-4,6-dione |
|---|---|
| PubChem CID | 102501631 |
| Molecular Formula | C9H10N2O3 |
| Molecular Weight | 194.19 g/mol |
| Exact Mass | 194.07 |
| IUPAC Name | 5-ethyl-7,8-dihydrofuro[2,3-e][1,3]diazepine-4,6-dione |
| SMILES | CCN1C(=O)NCc2occc2C1=O |
| InChI | InChI=1S/C9H10N2O3/c1-2-11-8(12)6-3-4-14-7(6)5-10-9(11)13/h3-4H,2,5H2,1H3,(H,10,13) |
| InChIKey | RJBUKEALDOBXLS-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.19 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |