C16H13ClINO — CID 10250214
(2R,6R)-9-chloro-17-iodo-13-oxa-4-azatetracyclo[12.4.0.02,6.07,12]octadeca-1(14),7(12),8,10,15,17-hexaene (PubChem CID 10250214) has the molecular formula C16H13ClINO and a molecular weight of 397.64 g/mol. Its IUPAC name is (2R,6R)-9-chloro-17-iodo-13-oxa-4-azatetracyclo[12.4.0.02,6.07,12]octadeca-1(14),7(12),8,10,15,17-hexaene.
| Compound Name | (2R,6R)-9-chloro-17-iodo-13-oxa-4-azatetracyclo[12.4.0.02,6.07,12]octadeca-1(14),7(12),8,10,15,17-hexaene |
|---|---|
| PubChem CID | 10250214 |
| Molecular Formula | C16H13ClINO |
| Molecular Weight | 397.64 g/mol |
| Exact Mass | 396.97 |
| IUPAC Name | (2R,6R)-9-chloro-17-iodo-13-oxa-4-azatetracyclo[12.4.0.02,6.07,12]octadeca-1(14),7(12),8,10,15,17-hexaene |
| SMILES | Clc1ccc2c(c1)[C@@H]1CNC[C@H]1c1cc(I)ccc1O2 |
| InChI | InChI=1S/C16H13ClINO/c17-9-1-3-15-11(5-9)13-7-19-8-14(13)12-6-10(18)2-4-16(12)20-15/h1-6,13-14,19H,7-8H2/t13-,14-/m0/s1 |
| InChIKey | SPODRWASBQMSRV-KBPBESRZSA-N |
| XLogP | 4.52 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.64 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|