C21H34O8 — CID 102502324
6-[(E,2S)-2-hydroxy-6-methyl-7-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyhept-5-en-2-yl]-3-methylcyclohex-2-en-1-one (PubChem CID 102502324) has the molecular formula C21H34O8 and a molecular weight of 414.50 g/mol. Its IUPAC name is 6-[(E,2S)-2-hydroxy-6-methyl-7-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyhept-5-en-2-yl]-3-methylcyclohex-2-en-1-one.
| Compound Name | 6-[(E,2S)-2-hydroxy-6-methyl-7-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyhept-5-en-2-yl]-3-methylcyclohex-2-en-1-one |
|---|---|
| PubChem CID | 102502324 |
| Molecular Formula | C21H34O8 |
| Molecular Weight | 414.50 g/mol |
| Exact Mass | 414.23 |
| IUPAC Name | 6-[(E,2S)-2-hydroxy-6-methyl-7-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyhept-5-en-2-yl]-3-methylcyclohex-2-en-1-one |
| SMILES | CC1=CC(=O)C([C@@](C)(O)CC/C=C(\C)CO[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)CC1 |
| InChI | InChI=1S/C21H34O8/c1-12-6-7-14(15(23)9-12)21(3,27)8-4-5-13(2)11-28-20-19(26)18(25)17(24)16(10-22)29-20/h5,9,14,16-20,22,24-27H,4,6-8,10-11H2,1-3H3/b13-5+/t14?,16-,17-,18+,19-,20-,21+/m1/s1 |
| InChIKey | KMKHNGLUAQDULT-UWOCXACPSA-N |
| XLogP | 0.21 |
| TPSA | 136.68 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.50 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|