C30H22O8 — CID 102502352
(E)-1-[(2S,3S)-3-(3,4-dihydroxybenzoyl)-6-hydroxy-2-(4-hydroxyphenyl)-2,3-dihydro-1-benzofuran-5-yl]-3-(4-hydroxyphenyl)prop-2-en-1-one (PubChem CID 102502352) has the molecular formula C30H22O8 and a molecular weight of 510.50 g/mol. Its IUPAC name is (E)-1-[(2S,3S)-3-(3,4-dihydroxybenzoyl)-6-hydroxy-2-(4-hydroxyphenyl)-2,3-dihydro-1-benzofuran-5-yl]-3-(4-hydroxyphenyl)prop-2-en-1-one.
| Compound Name | (E)-1-[(2S,3S)-3-(3,4-dihydroxybenzoyl)-6-hydroxy-2-(4-hydroxyphenyl)-2,3-dihydro-1-benzofuran-5-yl]-3-(4-hydroxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 102502352 |
| Molecular Formula | C30H22O8 |
| Molecular Weight | 510.50 g/mol |
| Exact Mass | 510.13 |
| IUPAC Name | (E)-1-[(2S,3S)-3-(3,4-dihydroxybenzoyl)-6-hydroxy-2-(4-hydroxyphenyl)-2,3-dihydro-1-benzofuran-5-yl]-3-(4-hydroxyphenyl)prop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccc(O)cc1)c1cc2c(cc1O)O[C@H](c1ccc(O)cc1)[C@H]2C(=O)c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C30H22O8/c31-19-7-1-16(2-8-19)3-11-23(33)21-14-22-27(15-25(21)35)38-30(17-4-9-20(32)10-5-17)28(22)29(37)18-6-12-24(34)26(36)13-18/h1-15,28,30-32,34-36H/b11-3+/t28-,30-/m1/s1 |
| InChIKey | OWPVEOSYKPTAGN-DLUNCSMTSA-N |
| XLogP | 5.21 |
| TPSA | 144.52 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.50 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|