C17H20O6 — CID 102502393
[(1S,2R,4'S,7S,7aR)-4',7,7a-trimethyl-2',5,5'-trioxospiro[1,3,6,7-tetrahydroindene-2,3'-oxolane]-1-yl] acetate (PubChem CID 102502393) has the molecular formula C17H20O6 and a molecular weight of 320.34 g/mol. Its IUPAC name is [(1S,2R,4'S,7S,7aR)-4',7,7a-trimethyl-2',5,5'-trioxospiro[1,3,6,7-tetrahydroindene-2,3'-oxolane]-1-yl] acetate.
| Compound Name | [(1S,2R,4'S,7S,7aR)-4',7,7a-trimethyl-2',5,5'-trioxospiro[1,3,6,7-tetrahydroindene-2,3'-oxolane]-1-yl] acetate |
|---|---|
| PubChem CID | 102502393 |
| Molecular Formula | C17H20O6 |
| Molecular Weight | 320.34 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | [(1S,2R,4'S,7S,7aR)-4',7,7a-trimethyl-2',5,5'-trioxospiro[1,3,6,7-tetrahydroindene-2,3'-oxolane]-1-yl] acetate |
| SMILES | CC(=O)O[C@H]1[C@@]2(C)C(=CC(=O)C[C@@H]2C)C[C@]12C(=O)OC(=O)[C@H]2C |
| InChI | InChI=1S/C17H20O6/c1-8-5-12(19)6-11-7-17(9(2)13(20)23-15(17)21)14(16(8,11)4)22-10(3)18/h6,8-9,14H,5,7H2,1-4H3/t8-,9+,14-,16+,17+/m0/s1 |
| InChIKey | URGUVKXDLHOJHO-ZJDFPMJSSA-N |
| XLogP | 1.57 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.34 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|