About (4R,5R)-4-(hydroxymethyl)diazinane-4,5-diol
(4R,5R)-4-(hydroxymethyl)diazinane-4,5-diol (PubChem CID 102503272) has the molecular formula C5H12N2O3
and a molecular weight of 148.16 g/mol. Its IUPAC name is (4R,5R)-4-(hydroxymethyl)diazinane-4,5-diol.
Molecular Properties
| Compound Name | (4R,5R)-4-(hydroxymethyl)diazinane-4,5-diol |
| PubChem CID | 102503272 |
| Molecular Formula | C5H12N2O3 |
| Molecular Weight | 148.16 g/mol |
| Exact Mass | 148.08 |
| IUPAC Name | (4R,5R)-4-(hydroxymethyl)diazinane-4,5-diol |
| SMILES | OC[C@]1(O)CNNC[C@H]1O |
| InChI | InChI=1S/C5H12N2O3/c8-3-5(10)2-7-6-1-4(5)9/h4,6-10H,1-3H2/t4-,5-/m1/s1 |
| InChIKey | AASLDLQWWSWRHR-RFZPGFLSSA-N |
| XLogP | -2.82 |
| TPSA | 84.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.16 |
| LogP ≤ 5 | -2.82 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (4R,5R)-4-(hydroxymethyl)diazinane-4,5-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R,5R)-4-(hydroxymethyl)diazinane-4,5-diol?
The IUPAC name of (4R,5R)-4-(hydroxymethyl)diazinane-4,5-diol (CID 102503272) is (4R,5R)-4-(hydroxymethyl)diazinane-4,5-diol.
What is the SMILES notation for (4R,5R)-4-(hydroxymethyl)diazinane-4,5-diol?
The canonical SMILES for (4R,5R)-4-(hydroxymethyl)diazinane-4,5-diol is OC[C@]1(O)CNNC[C@H]1O.
What is the InChIKey of (4R,5R)-4-(hydroxymethyl)diazinane-4,5-diol?
The InChIKey is AASLDLQWWSWRHR-RFZPGFLSSA-N. The full InChI is InChI=1S/C5H12N2O3/c8-3-5(10)2-7-6-1-4(5)9/h4,6-10H,1-3H2/t4-,5-/m1/s1.
What are the key properties of (4R,5R)-4-(hydroxymethyl)diazinane-4,5-diol?
(4R,5R)-4-(hydroxymethyl)diazinane-4,5-diol has a molecular weight of 148.16 g/mol, XLogP of -2.82, 1 rotatable bonds, 5 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4R,5R)-4-(hydroxymethyl)diazinane-4,5-diol is sourced from PubChem (CID 102503272), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).