About 7-methoxy-3-phenyl-1,4-benzothiazine-4-carbonitrile
7-methoxy-3-phenyl-1,4-benzothiazine-4-carbonitrile (PubChem CID 102503274) has the molecular formula C16H12N2OS
and a molecular weight of 280.35 g/mol. Its IUPAC name is 7-methoxy-3-phenyl-1,4-benzothiazine-4-carbonitrile.
Molecular Properties
| Compound Name | 7-methoxy-3-phenyl-1,4-benzothiazine-4-carbonitrile |
| PubChem CID | 102503274 |
| Molecular Formula | C16H12N2OS |
| Molecular Weight | 280.35 g/mol |
| Exact Mass | 280.07 |
| IUPAC Name | 7-methoxy-3-phenyl-1,4-benzothiazine-4-carbonitrile |
| SMILES | COc1ccc2c(c1)SC=C(c1ccccc1)N2C#N |
| InChI | InChI=1S/C16H12N2OS/c1-19-13-7-8-14-16(9-13)20-10-15(18(14)11-17)12-5-3-2-4-6-12/h2-10H,1H3 |
| InChIKey | KMPSRRUJMOHYJD-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 36.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.35 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|
Analyze 7-methoxy-3-phenyl-1,4-benzothiazine-4-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methoxy-3-phenyl-1,4-benzothiazine-4-carbonitrile?
The IUPAC name of 7-methoxy-3-phenyl-1,4-benzothiazine-4-carbonitrile (CID 102503274) is 7-methoxy-3-phenyl-1,4-benzothiazine-4-carbonitrile.
What is the SMILES notation for 7-methoxy-3-phenyl-1,4-benzothiazine-4-carbonitrile?
The canonical SMILES for 7-methoxy-3-phenyl-1,4-benzothiazine-4-carbonitrile is COc1ccc2c(c1)SC=C(c1ccccc1)N2C#N.
What is the InChIKey of 7-methoxy-3-phenyl-1,4-benzothiazine-4-carbonitrile?
The InChIKey is KMPSRRUJMOHYJD-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12N2OS/c1-19-13-7-8-14-16(9-13)20-10-15(18(14)11-17)12-5-3-2-4-6-12/h2-10H,1H3.
What are the key properties of 7-methoxy-3-phenyl-1,4-benzothiazine-4-carbonitrile?
7-methoxy-3-phenyl-1,4-benzothiazine-4-carbonitrile has a molecular weight of 280.35 g/mol, XLogP of 4.09, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methoxy-3-phenyl-1,4-benzothiazine-4-carbonitrile is sourced from PubChem (CID 102503274), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).