C23H19F3N6O6 — CID 102503364
(2R)-2-methyl-6-nitro-2-[[4-[4-[[4-(trifluoromethoxy)phenoxy]methyl]triazol-1-yl]phenoxy]methyl]-3H-imidazo[2,1-b][1,3]oxazole (PubChem CID 102503364) has the molecular formula C23H19F3N6O6 and a molecular weight of 532.44 g/mol. Its IUPAC name is (2R)-2-methyl-6-nitro-2-[[4-[4-[[4-(trifluoromethoxy)phenoxy]methyl]triazol-1-yl]phenoxy]methyl]-3H-imidazo[2,1-b][1,3]oxazole.
| Compound Name | (2R)-2-methyl-6-nitro-2-[[4-[4-[[4-(trifluoromethoxy)phenoxy]methyl]triazol-1-yl]phenoxy]methyl]-3H-imidazo[2,1-b][1,3]oxazole |
|---|---|
| PubChem CID | 102503364 |
| Molecular Formula | C23H19F3N6O6 |
| Molecular Weight | 532.44 g/mol |
| Exact Mass | 532.13 |
| IUPAC Name | (2R)-2-methyl-6-nitro-2-[[4-[4-[[4-(trifluoromethoxy)phenoxy]methyl]triazol-1-yl]phenoxy]methyl]-3H-imidazo[2,1-b][1,3]oxazole |
| SMILES | C[C@]1(COc2ccc(-n3cc(COc4ccc(OC(F)(F)F)cc4)nn3)cc2)Cn2cc([N+](=O)[O-])nc2O1 |
| InChI | InChI=1S/C23H19F3N6O6/c1-22(13-30-11-20(32(33)34)27-21(30)38-22)14-36-18-4-2-16(3-5-18)31-10-15(28-29-31)12-35-17-6-8-19(9-7-17)37-23(24,25)26/h2-11H,12-14H2,1H3/t22-/m1/s1 |
| InChIKey | JYLNXPXYFPKIFB-JOCHJYFZSA-N |
| XLogP | 4.08 |
| TPSA | 128.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.44 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|