C18H17IO3 — CID 102503412
[(1S)-8-iodo-1,2,3,4-tetrahydronaphthalen-1-yl] (2R)-2-hydroxy-2-phenylacetate (PubChem CID 102503412) has the molecular formula C18H17IO3 and a molecular weight of 408.24 g/mol. Its IUPAC name is [(1S)-8-iodo-1,2,3,4-tetrahydronaphthalen-1-yl] (2R)-2-hydroxy-2-phenylacetate.
| Compound Name | [(1S)-8-iodo-1,2,3,4-tetrahydronaphthalen-1-yl] (2R)-2-hydroxy-2-phenylacetate |
|---|---|
| PubChem CID | 102503412 |
| Molecular Formula | C18H17IO3 |
| Molecular Weight | 408.24 g/mol |
| Exact Mass | 408.02 |
| IUPAC Name | [(1S)-8-iodo-1,2,3,4-tetrahydronaphthalen-1-yl] (2R)-2-hydroxy-2-phenylacetate |
| SMILES | O=C(O[C@H]1CCCc2cccc(I)c21)[C@H](O)c1ccccc1 |
| InChI | InChI=1S/C18H17IO3/c19-14-10-4-8-12-9-5-11-15(16(12)14)22-18(21)17(20)13-6-2-1-3-7-13/h1-4,6-8,10,15,17,20H,5,9,11H2/t15-,17+/m0/s1 |
| InChIKey | VWWCJEJPLBUXEC-DOTOQJQBSA-N |
| XLogP | 3.95 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.24 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|