About N-cyclohexyl-4,4-difluoro-2-methyl-2-(4-methylphenyl)butanamide
N-cyclohexyl-4,4-difluoro-2-methyl-2-(4-methylphenyl)butanamide (PubChem CID 102503438) has the molecular formula C18H25F2NO
and a molecular weight of 309.40 g/mol. Its IUPAC name is N-cyclohexyl-4,4-difluoro-2-methyl-2-(4-methylphenyl)butanamide.
Molecular Properties
| Compound Name | N-cyclohexyl-4,4-difluoro-2-methyl-2-(4-methylphenyl)butanamide |
| PubChem CID | 102503438 |
| Molecular Formula | C18H25F2NO |
| Molecular Weight | 309.40 g/mol |
| Exact Mass | 309.19 |
| IUPAC Name | N-cyclohexyl-4,4-difluoro-2-methyl-2-(4-methylphenyl)butanamide |
| SMILES | Cc1ccc(C(C)(CC(F)F)C(=O)NC2CCCCC2)cc1 |
| InChI | InChI=1S/C18H25F2NO/c1-13-8-10-14(11-9-13)18(2,12-16(19)20)17(22)21-15-6-4-3-5-7-15/h8-11,15-16H,3-7,12H2,1-2H3,(H,21,22) |
| InChIKey | NTLQYTATFXVOLT-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.40 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-cyclohexyl-4,4-difluoro-2-methyl-2-(4-methylphenyl)butanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclohexyl-4,4-difluoro-2-methyl-2-(4-methylphenyl)butanamide?
The IUPAC name of N-cyclohexyl-4,4-difluoro-2-methyl-2-(4-methylphenyl)butanamide (CID 102503438) is N-cyclohexyl-4,4-difluoro-2-methyl-2-(4-methylphenyl)butanamide.
What is the SMILES notation for N-cyclohexyl-4,4-difluoro-2-methyl-2-(4-methylphenyl)butanamide?
The canonical SMILES for N-cyclohexyl-4,4-difluoro-2-methyl-2-(4-methylphenyl)butanamide is Cc1ccc(C(C)(CC(F)F)C(=O)NC2CCCCC2)cc1.
What is the InChIKey of N-cyclohexyl-4,4-difluoro-2-methyl-2-(4-methylphenyl)butanamide?
The InChIKey is NTLQYTATFXVOLT-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H25F2NO/c1-13-8-10-14(11-9-13)18(2,12-16(19)20)17(22)21-15-6-4-3-5-7-15/h8-11,15-16H,3-7,12H2,1-2H3,(H,21,22).
What are the key properties of N-cyclohexyl-4,4-difluoro-2-methyl-2-(4-methylphenyl)butanamide?
N-cyclohexyl-4,4-difluoro-2-methyl-2-(4-methylphenyl)butanamide has a molecular weight of 309.40 g/mol, XLogP of 4.36, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclohexyl-4,4-difluoro-2-methyl-2-(4-methylphenyl)butanamide is sourced from PubChem (CID 102503438), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).